C17H11F3N2O3 — CID 58746084
4-[(3aS,7aR)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 58746084) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 4-[(3aS,7aR)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aS,7aR)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58746084 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-[(3aS,7aR)-7-methyl-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12C=CC(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H11F3N2O3/c1-16-5-4-11(25-16)12-13(16)15(24)22(14(12)23)9-3-2-8(7-21)10(6-9)17(18,19)20/h2-6,11-13H,1H3/t11?,12-,13+,16?/m1/s1 |
| InChIKey | KTSREGBNJFGKHV-WULFKBJJSA-N |
| XLogP | 2.41 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|