C28H24F3N3O4 — CID 58746111
4-[(3aS,7aR)-4-(2-cyanoethyl)-1,3-dioxo-7-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 58746111) has the molecular formula C28H24F3N3O4 and a molecular weight of 523.51 g/mol. Its IUPAC name is 4-[(3aS,7aR)-4-(2-cyanoethyl)-1,3-dioxo-7-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aS,7aR)-4-(2-cyanoethyl)-1,3-dioxo-7-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58746111 |
| Molecular Formula | C28H24F3N3O4 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 4-[(3aS,7aR)-4-(2-cyanoethyl)-1,3-dioxo-7-(2-phenylmethoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#CCCC12CCC(CCOCc3ccccc3)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H24F3N3O4/c29-28(30,31)21-15-20(8-7-19(21)16-33)34-24(35)22-23(25(34)36)27(11-10-26(22,38-27)9-4-13-32)12-14-37-17-18-5-2-1-3-6-18/h1-3,5-8,15,22-23H,4,9-12,14,17H2/t22-,23+,26?,27?/m1/s1 |
| InChIKey | XPLRNNQGUBNWFZ-JIRKYJOESA-N |
| XLogP | 4.89 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|