C24H32N2O5SSi — CID 58746126
(3aS,5R,7aR)-2-(1,3-benzothiazol-6-yl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58746126) has the molecular formula C24H32N2O5SSi and a molecular weight of 488.68 g/mol. Its IUPAC name is (3aS,5R,7aR)-2-(1,3-benzothiazol-6-yl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,5R,7aR)-2-(1,3-benzothiazol-6-yl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58746126 |
| Molecular Formula | C24H32N2O5SSi |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (3aS,5R,7aR)-2-(1,3-benzothiazol-6-yl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC12OC(CCO[Si](C)(C)C(C)(C)C)(C[C@H]1O)[C@@H]1C(=O)N(c3ccc4ncsc4c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H32N2O5SSi/c1-22(2,3)33(5,6)30-10-9-24-12-17(27)23(4,31-24)18-19(24)21(29)26(20(18)28)14-7-8-15-16(11-14)32-13-25-15/h7-8,11,13,17-19,27H,9-10,12H2,1-6H3/t17-,18-,19+,23?,24?/m1/s1 |
| InChIKey | OGRUNHHMWVTHKJ-RCDGMEKDSA-N |
| XLogP | 4.11 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|