About 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate
2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate (PubChem CID 58746167) has the molecular formula C16H19Cl2N3O2
and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate.
Molecular Properties
| Compound Name | 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate |
| PubChem CID | 58746167 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate |
| SMILES | CCc1c(Cc2cc(Cl)cc(Cl)c2)c(C)nn1CCOC(N)=O |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-3-15-14(8-11-6-12(17)9-13(18)7-11)10(2)20-21(15)4-5-23-16(19)22/h6-7,9H,3-5,8H2,1-2H3,(H2,19,22) |
| InChIKey | GCJNMJUNGCWDJV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate?
The IUPAC name of 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate (CID 58746167) is 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate.
What is the SMILES notation for 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate?
The canonical SMILES for 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate is CCc1c(Cc2cc(Cl)cc(Cl)c2)c(C)nn1CCOC(N)=O.
What is the InChIKey of 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate?
The InChIKey is GCJNMJUNGCWDJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2N3O2/c1-3-15-14(8-11-6-12(17)9-13(18)7-11)10(2)20-21(15)4-5-23-16(19)22/h6-7,9H,3-5,8H2,1-2H3,(H2,19,22).
What are the key properties of 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate?
2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate has a molecular weight of 356.25 g/mol, XLogP of 3.75, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3,5-dichlorophenyl)methyl]-5-ethyl-3-methylpyrazol-1-yl]ethyl carbamate is sourced from PubChem (CID 58746167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).