About N'-methylcyclopenta-1,3-diene-1-carboximidamide
N'-methylcyclopenta-1,3-diene-1-carboximidamide (PubChem CID 58746429) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is N'-methylcyclopenta-1,3-diene-1-carboximidamide.
Molecular Properties
| Compound Name | N'-methylcyclopenta-1,3-diene-1-carboximidamide |
| PubChem CID | 58746429 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | N'-methylcyclopenta-1,3-diene-1-carboximidamide |
| SMILES | C/N=C(\N)C1=CC=CC1 |
| InChI | InChI=1S/C7H10N2/c1-9-7(8)6-4-2-3-5-6/h2-4H,5H2,1H3,(H2,8,9) |
| InChIKey | HKRQWZHGMAOERK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methylcyclopenta-1,3-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylcyclopenta-1,3-diene-1-carboximidamide?
The IUPAC name of N'-methylcyclopenta-1,3-diene-1-carboximidamide (CID 58746429) is N'-methylcyclopenta-1,3-diene-1-carboximidamide.
What is the SMILES notation for N'-methylcyclopenta-1,3-diene-1-carboximidamide?
The canonical SMILES for N'-methylcyclopenta-1,3-diene-1-carboximidamide is C/N=C(\N)C1=CC=CC1.
What is the InChIKey of N'-methylcyclopenta-1,3-diene-1-carboximidamide?
The InChIKey is HKRQWZHGMAOERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-9-7(8)6-4-2-3-5-6/h2-4H,5H2,1H3,(H2,8,9).
What are the key properties of N'-methylcyclopenta-1,3-diene-1-carboximidamide?
N'-methylcyclopenta-1,3-diene-1-carboximidamide has a molecular weight of 122.17 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylcyclopenta-1,3-diene-1-carboximidamide is sourced from PubChem (CID 58746429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).