C26H27N5O5S2 — CID 58746467
N-[(1S)-1-(3H-imidazo[4,5-c]pyridin-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,4,5-trimethylbenzenesulfonamide (PubChem CID 58746467) has the molecular formula C26H27N5O5S2 and a molecular weight of 553.67 g/mol. Its IUPAC name is N-[(1S)-1-(3H-imidazo[4,5-c]pyridin-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,4,5-trimethylbenzenesulfonamide.
| Compound Name | N-[(1S)-1-(3H-imidazo[4,5-c]pyridin-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58746467 |
| Molecular Formula | C26H27N5O5S2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | N-[(1S)-1-(3H-imidazo[4,5-c]pyridin-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H](Cc2ccc(C3CC(=O)NS3(=O)=O)cc2)c2nc3ccncc3[nH]2)cc(C)c1C |
| InChI | InChI=1S/C26H27N5O5S2/c1-15-10-20(11-16(2)17(15)3)37(33,34)30-22(26-28-21-8-9-27-14-23(21)29-26)12-18-4-6-19(7-5-18)24-13-25(32)31-38(24,35)36/h4-11,14,22,24,30H,12-13H2,1-3H3,(H,28,29)(H,31,32)/t22-,24?/m0/s1 |
| InChIKey | SWNBNGRTJREYQP-OWJIYDKWSA-N |
| XLogP | 3.04 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |