C31H34O5 — CID 58746982
1,3,4,5,6,8-hexamethyl-2,7-bis(oxiran-2-ylmethoxy)-9-phenyl-9H-xanthene (PubChem CID 58746982) has the molecular formula C31H34O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexamethyl-2,7-bis(oxiran-2-ylmethoxy)-9-phenyl-9H-xanthene.
| Compound Name | 1,3,4,5,6,8-hexamethyl-2,7-bis(oxiran-2-ylmethoxy)-9-phenyl-9H-xanthene |
|---|---|
| PubChem CID | 58746982 |
| Molecular Formula | C31H34O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1,3,4,5,6,8-hexamethyl-2,7-bis(oxiran-2-ylmethoxy)-9-phenyl-9H-xanthene |
| SMILES | Cc1c(C)c2c(c(C)c1OCC1CO1)C(c1ccccc1)c1c(C)c(OCC3CO3)c(C)c(C)c1O2 |
| InChI | InChI=1S/C31H34O5/c1-16-18(3)30-25(20(5)28(16)34-14-23-12-32-23)27(22-10-8-7-9-11-22)26-21(6)29(35-15-24-13-33-24)17(2)19(4)31(26)36-30/h7-11,23-24,27H,12-15H2,1-6H3 |
| InChIKey | CCYZSFPSPHPQPQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|