About (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione
(2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione (PubChem CID 58747261) has the molecular formula C10H4Cl2O3
and a molecular weight of 243.04 g/mol. Its IUPAC name is (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione.
Molecular Properties
| Compound Name | (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione |
| PubChem CID | 58747261 |
| Molecular Formula | C10H4Cl2O3 |
| Molecular Weight | 243.04 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione |
| SMILES | O=C1/C(=C/O)C(=O)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C10H4Cl2O3/c11-4-1-5-8(7(12)2-4)10(15)6(3-13)9(5)14/h1-3,13H/b6-3- |
| InChIKey | ZJQUJEIGQBRAHA-UTCJRWHESA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.04 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione?
The IUPAC name of (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione (CID 58747261) is (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione.
What is the SMILES notation for (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione?
The canonical SMILES for (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione is O=C1/C(=C/O)C(=O)c2c(Cl)cc(Cl)cc21.
What is the InChIKey of (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione?
The InChIKey is ZJQUJEIGQBRAHA-UTCJRWHESA-N. The full InChI is InChI=1S/C10H4Cl2O3/c11-4-1-5-8(7(12)2-4)10(15)6(3-13)9(5)14/h1-3,13H/b6-3-.
What are the key properties of (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione?
(2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione has a molecular weight of 243.04 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4,6-dichloro-2-(hydroxymethylidene)indene-1,3-dione is sourced from PubChem (CID 58747261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).