C23H35F5O6 — CID 58747476
4-(1-ethylcyclopentyl)oxycarbonyl-2,2,4-trimethyl-6-(2,2,3,3,3-pentafluoropropoxycarbonyl)octanoic acid (PubChem CID 58747476) has the molecular formula C23H35F5O6 and a molecular weight of 502.52 g/mol. Its IUPAC name is 4-(1-ethylcyclopentyl)oxycarbonyl-2,2,4-trimethyl-6-(2,2,3,3,3-pentafluoropropoxycarbonyl)octanoic acid.
| Compound Name | 4-(1-ethylcyclopentyl)oxycarbonyl-2,2,4-trimethyl-6-(2,2,3,3,3-pentafluoropropoxycarbonyl)octanoic acid |
|---|---|
| PubChem CID | 58747476 |
| Molecular Formula | C23H35F5O6 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 4-(1-ethylcyclopentyl)oxycarbonyl-2,2,4-trimethyl-6-(2,2,3,3,3-pentafluoropropoxycarbonyl)octanoic acid |
| SMILES | CCC(CC(C)(CC(C)(C)C(=O)O)C(=O)OC1(CC)CCCC1)C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H35F5O6/c1-6-15(16(29)33-14-22(24,25)23(26,27)28)12-20(5,13-19(3,4)17(30)31)18(32)34-21(7-2)10-8-9-11-21/h15H,6-14H2,1-5H3,(H,30,31) |
| InChIKey | PYLKRNYWVXVEII-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|