C15H9F14NO3S — CID 58747506
[[2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(4-methylphenyl)heptylidene]amino] trifluoromethanesulfonate (PubChem CID 58747506) has the molecular formula C15H9F14NO3S and a molecular weight of 549.28 g/mol. Its IUPAC name is [[2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(4-methylphenyl)heptylidene]amino] trifluoromethanesulfonate.
| Compound Name | [[2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(4-methylphenyl)heptylidene]amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58747506 |
| Molecular Formula | C15H9F14NO3S |
| Molecular Weight | 549.28 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | [[2,3,3,4,4,5,5,6,6,7,7-undecafluoro-1-(4-methylphenyl)heptylidene]amino] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C(=NOS(=O)(=O)C(F)(F)F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C15H9F14NO3S/c1-6-2-4-7(5-3-6)8(30-33-34(31,32)15(27,28)29)9(16)11(19,20)13(23,24)14(25,26)12(21,22)10(17)18/h2-5,9-10H,1H3 |
| InChIKey | XIWJHQKVQQNQBM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.28 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|