C12H20O4S — CID 58747858
(1S,2R,6S,9S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,6]tridecane (PubChem CID 58747858) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is (1S,2R,6S,9S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1S,2R,6S,9S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 58747858 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (1S,2R,6S,9S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC1(C)OC[C@@H]2SC[C@H]3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C12H20O4S/c1-11(2)13-5-8-10(16-11)9-7(6-17-8)14-12(3,4)15-9/h7-10H,5-6H2,1-4H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | WYUMPMYULLFBMX-UTINFBMNSA-N |
| XLogP | 1.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |