About propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+)
propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) (PubChem CID 58748027) has the molecular formula C11H17NV
and a molecular weight of 214.21 g/mol. Its IUPAC name is propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+).
Molecular Properties
| Compound Name | propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) |
| PubChem CID | 58748027 |
| Molecular Formula | C11H17NV |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) |
| SMILES | CC(C)c1ccc[c-]n1.C[CH-]C.[V+2] |
| InChI | InChI=1S/C8H10N.C3H7.V/c1-7(2)8-5-3-4-6-9-8;1-3-2;/h3-5,7H,1-2H3;3H,1-2H3;/q2*-1;+2 |
| InChIKey | ZBPVMGRSVWVHJF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+)?
The IUPAC name of propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) (CID 58748027) is propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+).
What is the SMILES notation for propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+)?
The canonical SMILES for propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) is CC(C)c1ccc[c-]n1.C[CH-]C.[V+2].
What is the InChIKey of propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+)?
The InChIKey is ZBPVMGRSVWVHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.C3H7.V/c1-7(2)8-5-3-4-6-9-8;1-3-2;/h3-5,7H,1-2H3;3H,1-2H3;/q2*-1;+2.
What are the key properties of propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+)?
propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) has a molecular weight of 214.21 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;6-propan-2-yl-2H-pyridin-2-ide;vanadium(2+) is sourced from PubChem (CID 58748027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).