About 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione
3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione (PubChem CID 58748031) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione |
| PubChem CID | 58748031 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione |
| SMILES | CC(C)c1ccc2[nH]c(=O)n(C(C)C)c(=O)c2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-8(2)10-5-6-12-11(7-10)13(17)16(9(3)4)14(18)15-12/h5-9H,1-4H3,(H,15,18) |
| InChIKey | VBFFGVIXDBJAKS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione?
The IUPAC name of 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione (CID 58748031) is 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione.
What is the SMILES notation for 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione?
The canonical SMILES for 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione is CC(C)c1ccc2[nH]c(=O)n(C(C)C)c(=O)c2c1.
What is the InChIKey of 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione?
The InChIKey is VBFFGVIXDBJAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-8(2)10-5-6-12-11(7-10)13(17)16(9(3)4)14(18)15-12/h5-9H,1-4H3,(H,15,18).
What are the key properties of 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione?
3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione has a molecular weight of 246.31 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-di(propan-2-yl)-1H-quinazoline-2,4-dione is sourced from PubChem (CID 58748031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).