About 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione
2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 58748047) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione.
Molecular Properties
| Compound Name | 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione |
| PubChem CID | 58748047 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | CC(C)c1ccc2cc(=O)n(C(C)C)c(=O)n2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-9(2)11-5-6-12-7-13(17)16(10(3)4)14(18)15(12)8-11/h5-10H,1-4H3 |
| InChIKey | QHHPDUOTLIRBFQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione?
The IUPAC name of 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione (CID 58748047) is 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione.
What is the SMILES notation for 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione?
The canonical SMILES for 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione is CC(C)c1ccc2cc(=O)n(C(C)C)c(=O)n2c1.
What is the InChIKey of 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione?
The InChIKey is QHHPDUOTLIRBFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-9(2)11-5-6-12-7-13(17)16(10(3)4)14(18)15(12)8-11/h5-10H,1-4H3.
What are the key properties of 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione?
2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione has a molecular weight of 246.31 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-di(propan-2-yl)pyrido[1,2-c]pyrimidine-1,3-dione is sourced from PubChem (CID 58748047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).