C14H24N2 — CID 58748048
2,7-di(propan-2-yl)-1,3,4,8-tetrahydro-2,7-naphthyridine (PubChem CID 58748048) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)-1,3,4,8-tetrahydro-2,7-naphthyridine.
| Compound Name | 2,7-di(propan-2-yl)-1,3,4,8-tetrahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 58748048 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2,7-di(propan-2-yl)-1,3,4,8-tetrahydro-2,7-naphthyridine |
| SMILES | CC(C)N1C=CC2=C(C1)CN(C(C)C)CC2 |
| InChI | InChI=1S/C14H24N2/c1-11(2)15-7-5-13-6-8-16(12(3)4)10-14(13)9-15/h5,7,11-12H,6,8-10H2,1-4H3 |
| InChIKey | XYOCHWRPCKBBOR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |