C10H16S — CID 587485
2,5-dipropylthiophene (PubChem CID 587485) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is 2,5-dipropylthiophene.
| Compound Name | 2,5-dipropylthiophene |
|---|---|
| PubChem CID | 587485 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2,5-dipropylthiophene |
| SMILES | CCCc1ccc(CCC)s1 |
| InChI | InChI=1S/C10H16S/c1-3-5-9-7-8-10(11-9)6-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | GYUMBXPBGKUOMU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |