About tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate
tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate (PubChem CID 58748607) has the molecular formula C23H33N3O4
and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate |
| PubChem CID | 58748607 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate |
| SMILES | CC(C)(C)CNCC(=O)N1CC(=O)N(C2CC2)c2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C23H33N3O4/c1-22(2,3)14-24-12-19(27)25-13-20(28)26(16-8-9-16)17-10-7-15(11-18(17)25)21(29)30-23(4,5)6/h7,10-11,16,24H,8-9,12-14H2,1-6H3 |
| InChIKey | YOUMCQWURJJOLE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate?
The IUPAC name of tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate (CID 58748607) is tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate.
What is the SMILES notation for tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate?
The canonical SMILES for tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate is CC(C)(C)CNCC(=O)N1CC(=O)N(C2CC2)c2ccc(C(=O)OC(C)(C)C)cc21.
What is the InChIKey of tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate?
The InChIKey is YOUMCQWURJJOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O4/c1-22(2,3)14-24-12-19(27)25-13-20(28)26(16-8-9-16)17-10-7-15(11-18(17)25)21(29)30-23(4,5)6/h7,10-11,16,24H,8-9,12-14H2,1-6H3.
What are the key properties of tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate?
tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate has a molecular weight of 415.53 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-cyclopropyl-4-[2-(2,2-dimethylpropylamino)acetyl]-2-oxo-3H-quinoxaline-6-carboxylate is sourced from PubChem (CID 58748607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).