C16H19N5O4 — CID 58748714
N-(2-hydroxyethyl)-4-[(5-nitropyrimidin-2-yl)amino]-N-propan-2-ylbenzamide (PubChem CID 58748714) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[(5-nitropyrimidin-2-yl)amino]-N-propan-2-ylbenzamide.
| Compound Name | N-(2-hydroxyethyl)-4-[(5-nitropyrimidin-2-yl)amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 58748714 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[(5-nitropyrimidin-2-yl)amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CCO)C(=O)c1ccc(Nc2ncc([N+](=O)[O-])cn2)cc1 |
| InChI | InChI=1S/C16H19N5O4/c1-11(2)20(7-8-22)15(23)12-3-5-13(6-4-12)19-16-17-9-14(10-18-16)21(24)25/h3-6,9-11,22H,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | MMCNHIVAUYBGSE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|