C27H25N3O4 — CID 58748843
methyl 3-phenyl-2-[[3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]propanoate (PubChem CID 58748843) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is methyl 3-phenyl-2-[[3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-phenyl-2-[[3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 58748843 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | methyl 3-phenyl-2-[[3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)c1cc(-c2ccc(OCc3ccccc3)cc2)n[nH]1 |
| InChI | InChI=1S/C27H25N3O4/c1-33-27(32)25(16-19-8-4-2-5-9-19)28-26(31)24-17-23(29-30-24)21-12-14-22(15-13-21)34-18-20-10-6-3-7-11-20/h2-15,17,25H,16,18H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | LNLRIGPSKHLHRY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |