C23H38F2O4 — CID 58749576
propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-oxocyclopent-3-en-1-yl]heptanoate (PubChem CID 58749576) has the molecular formula C23H38F2O4 and a molecular weight of 416.55 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-oxocyclopent-3-en-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-oxocyclopent-3-en-1-yl]heptanoate |
|---|---|
| PubChem CID | 58749576 |
| Molecular Formula | C23H38F2O4 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-hydroxyoctyl)-5-oxocyclopent-3-en-1-yl]heptanoate |
| SMILES | CCCCC(F)(F)C(O)CC[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C23H38F2O4/c1-4-5-16-23(24,25)21(27)15-13-18-12-14-20(26)19(18)10-8-6-7-9-11-22(28)29-17(2)3/h12,14,17-19,21,27H,4-11,13,15-16H2,1-3H3/t18-,19-,21?/m1/s1 |
| InChIKey | MIBDKDNGUVGXFX-AQFHOAJTSA-N |
| XLogP | 5.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|