C24H38F2O4 — CID 58749578
propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopent-3-en-1-yl]heptanoate (PubChem CID 58749578) has the molecular formula C24H38F2O4 and a molecular weight of 428.56 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopent-3-en-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopent-3-en-1-yl]heptanoate |
|---|---|
| PubChem CID | 58749578 |
| Molecular Formula | C24H38F2O4 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | propan-2-yl 7-[(1R,2S)-2-(4,4-difluoro-3-oxononyl)-5-oxocyclopent-3-en-1-yl]heptanoate |
| SMILES | CCCCCC(F)(F)C(=O)CC[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C24H38F2O4/c1-4-5-10-17-24(25,26)22(28)16-14-19-13-15-21(27)20(19)11-8-6-7-9-12-23(29)30-18(2)3/h13,15,18-20H,4-12,14,16-17H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | PWOJSJGIBHZQQQ-WOJBJXKFSA-N |
| XLogP | 6.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|