C29H33N7O2S — CID 58749714
(6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 58749714) has the molecular formula C29H33N7O2S and a molecular weight of 543.70 g/mol. Its IUPAC name is (6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 58749714 |
| Molecular Formula | C29H33N7O2S |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2nc3sc(C(=O)N[C@H](CN)c4cccc(NC(=O)c5nccnc5N)c4)cc3cc2C1 |
| InChI | InChI=1S/C29H33N7O2S/c1-29(2,3)19-7-8-21-17(12-19)11-18-14-23(39-28(18)36-21)26(37)35-22(15-30)16-5-4-6-20(13-16)34-27(38)24-25(31)33-10-9-32-24/h4-6,9-11,13-14,19,22H,7-8,12,15,30H2,1-3H3,(H2,31,33)(H,34,38)(H,35,37)/t19-,22-/m1/s1 |
| InChIKey | LUCVFSLZYDTBPJ-DENIHFKCSA-N |
| XLogP | 4.50 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |