C34H40N6O4S — CID 58749761
tert-butyl N-[(2S)-2-[[(6R)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-2-[4-(pyrazine-2-carbonylamino)phenyl]ethyl]carbamate (PubChem CID 58749761) has the molecular formula C34H40N6O4S and a molecular weight of 628.80 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[[(6R)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-2-[4-(pyrazine-2-carbonylamino)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[[(6R)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-2-[4-(pyrazine-2-carbonylamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 58749761 |
| Molecular Formula | C34H40N6O4S |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | tert-butyl N-[(2S)-2-[[(6R)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl]amino]-2-[4-(pyrazine-2-carbonylamino)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](NC(=O)c1cc2cc3c(nc2s1)CC[C@@H](C(C)(C)C)C3)c1ccc(NC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C34H40N6O4S/c1-33(2,3)23-9-12-25-21(16-23)15-22-17-28(45-31(22)40-25)30(42)39-26(19-37-32(43)44-34(4,5)6)20-7-10-24(11-8-20)38-29(41)27-18-35-13-14-36-27/h7-8,10-11,13-15,17-18,23,26H,9,12,16,19H2,1-6H3,(H,37,43)(H,38,41)(H,39,42)/t23-,26-/m1/s1 |
| InChIKey | XUSVEKORAMPHTB-ZEQKJWHPSA-N |
| XLogP | 6.49 |
| TPSA | 135.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |