C30H35N7O2S — CID 58749894
(6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 58749894) has the molecular formula C30H35N7O2S and a molecular weight of 557.72 g/mol. Its IUPAC name is (6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | (6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 58749894 |
| Molecular Formula | C30H35N7O2S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (6R)-N-[(1S)-2-amino-1-[3-[(3-aminopyrazine-2-carbonyl)amino]phenyl]ethyl]-6-(2-methylbutan-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CCC(C)(C)[C@@H]1CCc2nc3sc(C(=O)N[C@H](CN)c4cccc(NC(=O)c5nccnc5N)c4)cc3cc2C1 |
| InChI | InChI=1S/C30H35N7O2S/c1-4-30(2,3)20-8-9-22-18(13-20)12-19-15-24(40-29(19)37-22)27(38)36-23(16-31)17-6-5-7-21(14-17)35-28(39)25-26(32)34-11-10-33-25/h5-7,10-12,14-15,20,23H,4,8-9,13,16,31H2,1-3H3,(H2,32,34)(H,35,39)(H,36,38)/t20-,23-/m1/s1 |
| InChIKey | IJVMAAZDTOQQIR-NFBKMPQASA-N |
| XLogP | 4.89 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |