C25H28N2O6 — CID 58750162
(6Z,9S,12E)-9,18-dihydroxy-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 58750162) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (6Z,9S,12E)-9,18-dihydroxy-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (6Z,9S,12E)-9,18-dihydroxy-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 58750162 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (6Z,9S,12E)-9,18-dihydroxy-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | O=C1OCC/C=C\C(=O)[C@@H](O)CC/C=C/c2cc(OCCCNc3ccccn3)cc(O)c21 |
| InChI | InChI=1S/C25H28N2O6/c28-20-9-2-1-8-18-16-19(32-15-7-13-27-23-11-3-5-12-26-23)17-22(30)24(18)25(31)33-14-6-4-10-21(20)29/h1,3-5,8,10-12,16-17,20,28,30H,2,6-7,9,13-15H2,(H,26,27)/b8-1+,10-4-/t20-/m0/s1 |
| InChIKey | LKNUSOCJCDIELO-JUIGNLMUSA-N |
| XLogP | 3.51 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|