C20H22F2O7 — CID 58750273
(4S,5R,6Z,12E)-16-(difluoromethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 58750273) has the molecular formula C20H22F2O7 and a molecular weight of 412.39 g/mol. Its IUPAC name is (4S,5R,6Z,12E)-16-(difluoromethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,12E)-16-(difluoromethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 58750273 |
| Molecular Formula | C20H22F2O7 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (4S,5R,6Z,12E)-16-(difluoromethoxy)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)C(O)C(O)C/C=C/c2cc(OC(F)F)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C20H22F2O7/c1-10-6-7-15(24)18(26)14(23)5-3-4-12-8-13(29-20(21)22)9-16(25)17(12)19(27)28-11(10)2/h3-4,6-11,14,18,20,23,25-26H,5H2,1-2H3/b4-3+,7-6-/t10-,11+,14?,18?/m1/s1 |
| InChIKey | ZBPAVPIMVBPZDW-MNMHFYSRSA-N |
| XLogP | 2.44 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |