C27H34N2O7 — CID 58750294
(5R,6Z,9S,10S,12E)-8,9,10,18-tetrahydroxy-4,5-dimethyl-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one (PubChem CID 58750294) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is (5R,6Z,9S,10S,12E)-8,9,10,18-tetrahydroxy-4,5-dimethyl-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one.
| Compound Name | (5R,6Z,9S,10S,12E)-8,9,10,18-tetrahydroxy-4,5-dimethyl-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58750294 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (5R,6Z,9S,10S,12E)-8,9,10,18-tetrahydroxy-4,5-dimethyl-16-[3-(pyridin-2-ylamino)propoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one |
| SMILES | CC1OC(=O)c2c(O)cc(OCCCNc3ccccn3)cc2/C=C/C[C@H](O)[C@H](O)C(O)/C=C\[C@H]1C |
| InChI | InChI=1S/C27H34N2O7/c1-17-10-11-22(31)26(33)21(30)8-5-7-19-15-20(16-23(32)25(19)27(34)36-18(17)2)35-14-6-13-29-24-9-3-4-12-28-24/h3-5,7,9-12,15-18,21-22,26,30-33H,6,8,13-14H2,1-2H3,(H,28,29)/b7-5+,11-10-/t17-,18?,21+,22?,26+/m1/s1 |
| InChIKey | RFJRIKGMJYEFSC-LKWOKBLYSA-N |
| XLogP | 2.91 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|