About tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane
tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane (PubChem CID 58750402) has the molecular formula C12H24Br2OSi
and a molecular weight of 372.22 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane |
| PubChem CID | 58750402 |
| Molecular Formula | C12H24Br2OSi |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane |
| SMILES | C[C@H](C=C(Br)Br)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24Br2OSi/c1-9(8-11(13)14)10(2)15-16(6,7)12(3,4)5/h8-10H,1-7H3/t9-,10-/m1/s1 |
| InChIKey | DPFCAMAVEHHDMW-NXEZZACHSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane (CID 58750402) is tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane is C[C@H](C=C(Br)Br)[C@@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane?
The InChIKey is DPFCAMAVEHHDMW-NXEZZACHSA-N. The full InChI is InChI=1S/C12H24Br2OSi/c1-9(8-11(13)14)10(2)15-16(6,7)12(3,4)5/h8-10H,1-7H3/t9-,10-/m1/s1.
What are the key properties of tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane?
tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane has a molecular weight of 372.22 g/mol, XLogP of 5.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2R,3R)-5,5-dibromo-3-methylpent-4-en-2-yl]oxy-dimethylsilane is sourced from PubChem (CID 58750402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).