C32H26O16S4 — CID 58750506
2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-5-[3-sulfo-5-(trioxidanylsulfanyl)phenoxy]-3-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 58750506) has the molecular formula C32H26O16S4 and a molecular weight of 794.81 g/mol. Its IUPAC name is 2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-5-[3-sulfo-5-(trioxidanylsulfanyl)phenoxy]-3-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-5-[3-sulfo-5-(trioxidanylsulfanyl)phenoxy]-3-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58750506 |
| Molecular Formula | C32H26O16S4 |
| Molecular Weight | 794.81 g/mol |
| Exact Mass | 794.01 |
| IUPAC Name | 2-[4-[1,1-bis(4-hydroxyphenyl)ethyl]phenoxy]-5-[3-sulfo-5-(trioxidanylsulfanyl)phenoxy]-3-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(Oc2c(SOOO)cc(Oc3cc(SOOO)cc(S(=O)(=O)O)c3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C32H26O16S4/c1-32(19-2-8-22(33)9-3-19,20-4-10-23(34)11-5-20)21-6-12-24(13-7-21)44-31-29(50-48-46-36)16-26(17-30(31)52(40,41)42)43-25-14-27(49-47-45-35)18-28(15-25)51(37,38)39/h2-18,33-36H,1H3,(H,37,38,39)(H,40,41,42) |
| InChIKey | GGJCDEXMFDFIOG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 245.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.81 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|