C33H18F4N4 — CID 58750683
9-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]pyrido[3,4-b]indole (PubChem CID 58750683) has the molecular formula C33H18F4N4 and a molecular weight of 546.53 g/mol. Its IUPAC name is 9-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]pyrido[3,4-b]indole.
| Compound Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 58750683 |
| Molecular Formula | C33H18F4N4 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]pyrido[3,4-b]indole |
| SMILES | Fc1c(F)c(-n2c3ccccc3c3ccncc32)c(F)c(F)c1-c1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C33H18F4N4/c34-28-27(24-17-23(19-9-3-1-4-10-19)39-33(40-24)20-11-5-2-6-12-20)29(35)31(37)32(30(28)36)41-25-14-8-7-13-21(25)22-15-16-38-18-26(22)41/h1-18H |
| InChIKey | YEUMASNTDFRNQY-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|