C14H17BrN2O4S — CID 58751635
(2R,3aR,6aR)-1-(4-bromophenyl)sulfonyl-N-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide (PubChem CID 58751635) has the molecular formula C14H17BrN2O4S and a molecular weight of 389.27 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-(4-bromophenyl)sulfonyl-N-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-1-(4-bromophenyl)sulfonyl-N-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 58751635 |
| Molecular Formula | C14H17BrN2O4S |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | (2R,3aR,6aR)-1-(4-bromophenyl)sulfonyl-N-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
| SMILES | O=C(NO)[C@H]1C[C@H]2CCC[C@H]2N1S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrN2O4S/c15-10-4-6-11(7-5-10)22(20,21)17-12-3-1-2-9(12)8-13(17)14(18)16-19/h4-7,9,12-13,19H,1-3,8H2,(H,16,18)/t9-,12-,13-/m1/s1 |
| InChIKey | NYYJBHDDRHRYJI-OASPWFOLSA-N |
| XLogP | 1.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|