C15H20N2O6S2 — CID 58751643
(2R,3aR,6aR)-N-hydroxy-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide (PubChem CID 58751643) has the molecular formula C15H20N2O6S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2R,3aR,6aR)-N-hydroxy-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-N-hydroxy-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 58751643 |
| Molecular Formula | C15H20N2O6S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2R,3aR,6aR)-N-hydroxy-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2[C@@H](C(=O)NO)C[C@H]3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C15H20N2O6S2/c1-24(20,21)11-5-7-12(8-6-11)25(22,23)17-13-4-2-3-10(13)9-14(17)15(18)16-19/h5-8,10,13-14,19H,2-4,9H2,1H3,(H,16,18)/t10-,13-,14-/m1/s1 |
| InChIKey | DQGIZCLJJMSJOQ-LERXQTSPSA-N |
| XLogP | 0.53 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|