C19H23N3O2S — CID 58751896
(1S,2S)-1-(1-methyl-4-phenylimidazol-2-yl)-3-(2-thiophen-2-ylethylamino)propane-1,2-diol (PubChem CID 58751896) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (1S,2S)-1-(1-methyl-4-phenylimidazol-2-yl)-3-(2-thiophen-2-ylethylamino)propane-1,2-diol.
| Compound Name | (1S,2S)-1-(1-methyl-4-phenylimidazol-2-yl)-3-(2-thiophen-2-ylethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 58751896 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (1S,2S)-1-(1-methyl-4-phenylimidazol-2-yl)-3-(2-thiophen-2-ylethylamino)propane-1,2-diol |
| SMILES | Cn1cc(-c2ccccc2)nc1[C@H](O)[C@@H](O)CNCCc1cccs1 |
| InChI | InChI=1S/C19H23N3O2S/c1-22-13-16(14-6-3-2-4-7-14)21-19(22)18(24)17(23)12-20-10-9-15-8-5-11-25-15/h2-8,11,13,17-18,20,23-24H,9-10,12H2,1H3/t17-,18+/m0/s1 |
| InChIKey | OWCSBDDNHCTIIP-ZWKOTPCHSA-N |
| XLogP | 2.38 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|