C21H12F3N3 — CID 58752538
2,4,6-tris(4-fluorophenyl)-1,3,5-triazine (PubChem CID 58752538) has the molecular formula C21H12F3N3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2,4,6-tris(4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58752538 |
| Molecular Formula | C21H12F3N3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2,4,6-tris(4-fluorophenyl)-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H12F3N3/c22-16-7-1-13(2-8-16)19-25-20(14-3-9-17(23)10-4-14)27-21(26-19)15-5-11-18(24)12-6-15/h1-12H |
| InChIKey | NUHWHLSPHBVPKM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |