About But-3-en-1-yl 2-methylbutanoate
But-3-en-1-yl 2-methylbutanoate (PubChem CID 58752957) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is but-3-enyl 2-methylbutanoate.
Molecular Properties
| Compound Name | But-3-en-1-yl 2-methylbutanoate |
| PubChem CID | 58752957 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | but-3-enyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCC=C |
| InChI | InChI=1S/C9H16O2/c1-4-6-7-11-9(10)8(3)5-2/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | ORRLHHCDNBNPRD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | 130 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze But-3-en-1-yl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of But-3-en-1-yl 2-methylbutanoate?
The IUPAC name of But-3-en-1-yl 2-methylbutanoate (CID 58752957) is but-3-enyl 2-methylbutanoate.
What is the SMILES notation for But-3-en-1-yl 2-methylbutanoate?
The canonical SMILES for But-3-en-1-yl 2-methylbutanoate is CCC(C)C(=O)OCCC=C.
What is the InChIKey of But-3-en-1-yl 2-methylbutanoate?
The InChIKey is ORRLHHCDNBNPRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-6-7-11-9(10)8(3)5-2/h4,8H,1,5-7H2,2-3H3.
What are the key properties of But-3-en-1-yl 2-methylbutanoate?
But-3-en-1-yl 2-methylbutanoate has a molecular weight of 156.22 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for But-3-en-1-yl 2-methylbutanoate is sourced from PubChem (CID 58752957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).