C22H27N3O5 — CID 58752958
2-[[8-(2-hydroxy-5-methylphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]oxymethoxy]ethyl 2,2-dimethylbutanoate (PubChem CID 58752958) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-[[8-(2-hydroxy-5-methylphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]oxymethoxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[8-(2-hydroxy-5-methylphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]oxymethoxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58752958 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[[8-(2-hydroxy-5-methylphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]oxymethoxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOCOc1ccc2c(c1)n1n(-c3cc(C)ccc3O)n21 |
| InChI | InChI=1S/C22H27N3O5/c1-5-22(3,4)21(27)29-11-10-28-14-30-16-7-8-17-18(13-16)24-23(17)25(24)19-12-15(2)6-9-20(19)26/h6-9,12-13,26H,5,10-11,14H2,1-4H3 |
| InChIKey | NDXXSAJLOWMLHC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|