C13H19N3O5 — CID 58754410
3,4-dihydroxy-2,4-dimethyl-6-oxo-7-propyl-1,3-dihydropyrimido[1,6-a]pyrimidin-7-ium-2-carboxylate (PubChem CID 58754410) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3,4-dihydroxy-2,4-dimethyl-6-oxo-7-propyl-1,3-dihydropyrimido[1,6-a]pyrimidin-7-ium-2-carboxylate.
| Compound Name | 3,4-dihydroxy-2,4-dimethyl-6-oxo-7-propyl-1,3-dihydropyrimido[1,6-a]pyrimidin-7-ium-2-carboxylate |
|---|---|
| PubChem CID | 58754410 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3,4-dihydroxy-2,4-dimethyl-6-oxo-7-propyl-1,3-dihydropyrimido[1,6-a]pyrimidin-7-ium-2-carboxylate |
| SMILES | CCC[n+]1ccc2n(c1=O)C(C)(O)C(O)C(C)(C(=O)[O-])N2 |
| InChI | InChI=1S/C13H19N3O5/c1-4-6-15-7-5-8-14-12(2,10(18)19)9(17)13(3,21)16(8)11(15)20/h5,7,9,17,21H,4,6H2,1-3H3,(H,18,19) |
| InChIKey | NTHWKWRMMBLMKZ-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|