About (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium
(2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium (PubChem CID 58755392) has the molecular formula C9H10N2WY-2
and a molecular weight of 418.94 g/mol. Its IUPAC name is (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium.
Molecular Properties
| Compound Name | (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium |
| PubChem CID | 58755392 |
| Molecular Formula | C9H10N2WY-2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium |
| SMILES | Cc1[c-]cc(C=NN)c(C)[c-]1.[W].[Y] |
| InChI | InChI=1S/C9H10N2.W.Y/c1-7-3-4-9(6-11-10)8(2)5-7;;/h4,6H,10H2,1-2H3;;/q-2;; |
| InChIKey | FJHAMHBLMRRUHC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium?
The IUPAC name of (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium (CID 58755392) is (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium.
What is the SMILES notation for (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium?
The canonical SMILES for (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium is Cc1[c-]cc(C=NN)c(C)[c-]1.[W].[Y].
What is the InChIKey of (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium?
The InChIKey is FJHAMHBLMRRUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.W.Y/c1-7-3-4-9(6-11-10)8(2)5-7;;/h4,6H,10H2,1-2H3;;/q-2;;.
What are the key properties of (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium?
(2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium has a molecular weight of 418.94 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylbenzene-3,5-diid-1-yl)methylidenehydrazine;tungsten;yttrium is sourced from PubChem (CID 58755392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).