C12H14NO4S- — CID 58755397
(1R)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethanesulfonate (PubChem CID 58755397) has the molecular formula C12H14NO4S- and a molecular weight of 268.31 g/mol. Its IUPAC name is (1R)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethanesulfonate.
| Compound Name | (1R)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethanesulfonate |
|---|---|
| PubChem CID | 58755397 |
| Molecular Formula | C12H14NO4S- |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (1R)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethanesulfonate |
| SMILES | C[C@H](c1ccc(N2CCCC2=O)cc1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H15NO4S/c1-9(18(15,16)17)10-4-6-11(7-5-10)13-8-2-3-12(13)14/h4-7,9H,2-3,8H2,1H3,(H,15,16,17)/p-1/t9-/m1/s1 |
| InChIKey | SGPYDCPJRGQKAT-SECBINFHSA-M |
| XLogP | 1.42 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|