C16H23N3 — CID 58755437
4-azido-1,6-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 58755437) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-azido-1,6-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | 4-azido-1,6-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 58755437 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-azido-1,6-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | CC12CC3CC4C1CC1(N=[N+]=[N-])CC2C(C3)C4(C)C1 |
| InChI | InChI=1S/C16H23N3/c1-14-5-9-3-10-12(14)6-16(18-19-17)7-13(14)11(4-9)15(10,2)8-16/h9-13H,3-8H2,1-2H3 |
| InChIKey | AETILRIALWAQFH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|