About 9-propylpurin-2-amine
9-propylpurin-2-amine (PubChem CID 58755499) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 9-propylpurin-2-amine.
Molecular Properties
| Compound Name | 9-propylpurin-2-amine |
| PubChem CID | 58755499 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 9-propylpurin-2-amine |
| SMILES | CCCn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C8H11N5/c1-2-3-13-5-11-6-4-10-8(9)12-7(6)13/h4-5H,2-3H2,1H3,(H2,9,10,12) |
| InChIKey | VTUDGQKMHBBILI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-propylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-propylpurin-2-amine?
The IUPAC name of 9-propylpurin-2-amine (CID 58755499) is 9-propylpurin-2-amine.
What is the SMILES notation for 9-propylpurin-2-amine?
The canonical SMILES for 9-propylpurin-2-amine is CCCn1cnc2cnc(N)nc21.
What is the InChIKey of 9-propylpurin-2-amine?
The InChIKey is VTUDGQKMHBBILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-2-3-13-5-11-6-4-10-8(9)12-7(6)13/h4-5H,2-3H2,1H3,(H2,9,10,12).
What are the key properties of 9-propylpurin-2-amine?
9-propylpurin-2-amine has a molecular weight of 177.21 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-propylpurin-2-amine is sourced from PubChem (CID 58755499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).