About 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline
6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline (PubChem CID 58755618) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline.
Molecular Properties
| Compound Name | 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline |
| PubChem CID | 58755618 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline |
| SMILES | CC(C)Oc1nc2c(c3ccccc13)OCOC2 |
| InChI | InChI=1S/C14H15NO3/c1-9(2)18-14-11-6-4-3-5-10(11)13-12(15-14)7-16-8-17-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | XZCSOUQWRJGFIR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline?
The IUPAC name of 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline (CID 58755618) is 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline.
What is the SMILES notation for 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline?
The canonical SMILES for 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline is CC(C)Oc1nc2c(c3ccccc13)OCOC2.
What is the InChIKey of 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline?
The InChIKey is XZCSOUQWRJGFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-9(2)18-14-11-6-4-3-5-10(11)13-12(15-14)7-16-8-17-13/h3-6,9H,7-8H2,1-2H3.
What are the key properties of 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline?
6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline has a molecular weight of 245.28 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yloxy-4H-[1,3]dioxino[5,4-c]isoquinoline is sourced from PubChem (CID 58755618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).