About [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate (PubChem CID 58755992) has the molecular formula C15H11F7O2S
and a molecular weight of 388.30 g/mol. Its IUPAC name is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate |
| PubChem CID | 58755992 |
| Molecular Formula | C15H11F7O2S |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H11F7O2S/c1-8-5-9(2)14(12(17)6-8)15(23)24-10-3-4-13(11(16)7-10)25(18,19,20,21)22/h3-7H,1-2H3 |
| InChIKey | GBWMUSUPMVPOGK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate?
The IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate (CID 58755992) is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate.
What is the SMILES notation for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate?
The canonical SMILES for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate is Cc1cc(C)c(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)c(F)c1.
What is the InChIKey of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate?
The InChIKey is GBWMUSUPMVPOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F7O2S/c1-8-5-9(2)14(12(17)6-8)15(23)24-10-3-4-13(11(16)7-10)25(18,19,20,21)22/h3-7H,1-2H3.
What are the key properties of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate?
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate has a molecular weight of 388.30 g/mol, XLogP of 6.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2-fluoro-4,6-dimethylbenzoate is sourced from PubChem (CID 58755992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).