About [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate (PubChem CID 58756009) has the molecular formula C16H14F6O2S
and a molecular weight of 384.34 g/mol. Its IUPAC name is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate |
| PubChem CID | 58756009 |
| Molecular Formula | C16H14F6O2S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C16H14F6O2S/c1-9-6-10(2)15(11(3)7-9)16(23)24-12-4-5-14(13(17)8-12)25(18,19,20,21)22/h4-8H,1-3H3 |
| InChIKey | XYSMECVXIUBMCF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate?
The IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate (CID 58756009) is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate.
What is the SMILES notation for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate?
The canonical SMILES for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate is Cc1cc(C)c(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)c(C)c1.
What is the InChIKey of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate?
The InChIKey is XYSMECVXIUBMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F6O2S/c1-9-6-10(2)15(11(3)7-9)16(23)24-12-4-5-14(13(17)8-12)25(18,19,20,21)22/h4-8H,1-3H3.
What are the key properties of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate?
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate has a molecular weight of 384.34 g/mol, XLogP of 6.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,4,6-trimethylbenzoate is sourced from PubChem (CID 58756009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).