C24H20F4O2 — CID 58756043
[3-fluoro-4-methyl-5-(trifluoromethyl)phenyl] 4-(2,4-dimethylphenyl)-2-methylbenzoate (PubChem CID 58756043) has the molecular formula C24H20F4O2 and a molecular weight of 416.41 g/mol. Its IUPAC name is [3-fluoro-4-methyl-5-(trifluoromethyl)phenyl] 4-(2,4-dimethylphenyl)-2-methylbenzoate.
| Compound Name | [3-fluoro-4-methyl-5-(trifluoromethyl)phenyl] 4-(2,4-dimethylphenyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 58756043 |
| Molecular Formula | C24H20F4O2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [3-fluoro-4-methyl-5-(trifluoromethyl)phenyl] 4-(2,4-dimethylphenyl)-2-methylbenzoate |
| SMILES | Cc1ccc(-c2ccc(C(=O)Oc3cc(F)c(C)c(C(F)(F)F)c3)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C24H20F4O2/c1-13-5-7-19(14(2)9-13)17-6-8-20(15(3)10-17)23(29)30-18-11-21(24(26,27)28)16(4)22(25)12-18/h5-12H,1-4H3 |
| InChIKey | SQGNKBKKPDXNLS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|