About CID 58756157
CID 58756157 (PubChem CID 58756157) has the molecular formula C39H16F10N10Pt2
and a molecular weight of 1204.76 g/mol.
Molecular Properties
| Compound Name | CID 58756157 |
| PubChem CID | 58756157 |
| Molecular Formula | C39H16F10N10Pt2 |
| Molecular Weight | 1204.76 g/mol |
| Exact Mass | 1204.07 |
| IUPAC Name | — |
| SMILES | Fc1c[c-]c(-c2cccc(C(c3cccc(-c4[c-]cc(F)cc4F)n3)(c3cccc(-n4[c-]nc(C(F)(F)F)n4)n3)c3cccc(-n4[c-]nc(C(F)(F)F)n4)n3)n2)c(F)c1.[Pt+2].[Pt+2] |
| InChI | InChI=1S/C39H16F10N10.2Pt/c40-21-13-15-23(25(42)17-21)27-5-1-7-29(52-27)37(30-8-2-6-28(53-30)24-16-14-22(41)18-26(24)43,31-9-3-11-33(54-31)58-19-50-35(56-58)38(44,45)46)32-10-4-12-34(55-32)59-20-51-36(57-59)39(47,48)49;;/h1-14,17-18H;;/q-4;2*+2 |
| InChIKey | XAXVUUIVFFNWJX-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 112.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1204.76 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58756157 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58756157?
The IUPAC name of CID 58756157 (CID 58756157) is not available.
What is the SMILES notation for CID 58756157?
The canonical SMILES for CID 58756157 is Fc1c[c-]c(-c2cccc(C(c3cccc(-c4[c-]cc(F)cc4F)n3)(c3cccc(-n4[c-]nc(C(F)(F)F)n4)n3)c3cccc(-n4[c-]nc(C(F)(F)F)n4)n3)n2)c(F)c1.[Pt+2].[Pt+2].
What is the InChIKey of CID 58756157?
The InChIKey is XAXVUUIVFFNWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H16F10N10.2Pt/c40-21-13-15-23(25(42)17-21)27-5-1-7-29(52-27)37(30-8-2-6-28(53-30)24-16-14-22(41)18-26(24)43,31-9-3-11-33(54-31)58-19-50-35(56-58)38(44,45)46)32-10-4-12-34(55-32)59-20-51-36(57-59)39(47,48)49;;/h1-14,17-18H;;/q-4;2*+2.
What are the key properties of CID 58756157?
CID 58756157 has a molecular weight of 1204.76 g/mol, XLogP of 7.93, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58756157 is sourced from PubChem (CID 58756157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).