About bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+)
bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) (PubChem CID 58756167) has the molecular formula C34H28N4Pt
and a molecular weight of 687.70 g/mol. Its IUPAC name is bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+).
Molecular Properties
| Compound Name | bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) |
| PubChem CID | 58756167 |
| Molecular Formula | C34H28N4Pt |
| Molecular Weight | 687.70 g/mol |
| Exact Mass | 687.20 |
| IUPAC Name | bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) |
| SMILES | CC(c1[c-]cccc1)(c1[c-]cccc1)n1cccn1.CC(c1[c-]cccc1)(c1[c-]cccc1)n1cccn1.[Pt+4] |
| InChI | InChI=1S/2C17H14N2.Pt/c2*1-17(19-14-8-13-18-19,15-9-4-2-5-10-15)16-11-6-3-7-12-16;/h2*2-9,11,13-14H,1H3;/q2*-2;+4 |
| InChIKey | OCDMFQZMCGCRQM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 687.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+)?
The IUPAC name of bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) (CID 58756167) is bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+).
What is the SMILES notation for bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+)?
The canonical SMILES for bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) is CC(c1[c-]cccc1)(c1[c-]cccc1)n1cccn1.CC(c1[c-]cccc1)(c1[c-]cccc1)n1cccn1.[Pt+4].
What is the InChIKey of bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+)?
The InChIKey is OCDMFQZMCGCRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H14N2.Pt/c2*1-17(19-14-8-13-18-19,15-9-4-2-5-10-15)16-11-6-3-7-12-16;/h2*2-9,11,13-14H,1H3;/q2*-2;+4.
What are the key properties of bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+)?
bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) has a molecular weight of 687.70 g/mol, XLogP of 6.59, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-[1,1-di(phenyl)ethyl]pyrazole);platinum(4+) is sourced from PubChem (CID 58756167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).