C23H21F6IrN2O2- — CID 58756229
iridium;pentane-2,4-diol;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine (PubChem CID 58756229) has the molecular formula C23H21F6IrN2O2- and a molecular weight of 663.64 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | iridium;pentane-2,4-diol;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 58756229 |
| Molecular Formula | C23H21F6IrN2O2- |
| Molecular Weight | 663.64 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | iridium;pentane-2,4-diol;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine |
| SMILES | CC(O)CC(C)O.FC(F)(F)c1c[c-]c(-c2nccnc2-c2ccc(C(F)(F)F)cc2)cc1.[Ir] |
| InChI | InChI=1S/C18H9F6N2.C5H12O2.Ir/c19-17(20,21)13-5-1-11(2-6-13)15-16(26-10-9-25-15)12-3-7-14(8-4-12)18(22,23)24;1-4(6)3-5(2)7;/h1-3,5-10H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | OWWNZWIYDBEIAE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|