C16H20N2 — CID 58756295
4,5,10,12,12-pentamethyl-9,13-diazatricyclo[6.5.0.03,6]trideca-1(13),2,6,8,10-pentaene (PubChem CID 58756295) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 4,5,10,12,12-pentamethyl-9,13-diazatricyclo[6.5.0.03,6]trideca-1(13),2,6,8,10-pentaene.
| Compound Name | 4,5,10,12,12-pentamethyl-9,13-diazatricyclo[6.5.0.03,6]trideca-1(13),2,6,8,10-pentaene |
|---|---|
| PubChem CID | 58756295 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4,5,10,12,12-pentamethyl-9,13-diazatricyclo[6.5.0.03,6]trideca-1(13),2,6,8,10-pentaene |
| SMILES | CC1=CC(C)(C)N=c2cc3c(cc2=N1)C(C)C3C |
| InChI | InChI=1S/C16H20N2/c1-9-8-16(4,5)18-15-7-13-11(3)10(2)12(13)6-14(15)17-9/h6-8,10-11H,1-5H3 |
| InChIKey | RVGOHIXKWYYQCM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |