About 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one
4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one (PubChem CID 58756306) has the molecular formula C17H30OS
and a molecular weight of 282.49 g/mol. Its IUPAC name is 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one |
| PubChem CID | 58756306 |
| Molecular Formula | C17H30OS |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one |
| SMILES | CCCCSC(CC(C)=O)C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H30OS/c1-6-7-11-19-15(12-14(3)18)16-13(2)9-8-10-17(16,4)5/h9,15-16H,6-8,10-12H2,1-5H3 |
| InChIKey | CDHHFGQDWHWCEB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one?
The IUPAC name of 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one (CID 58756306) is 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one.
What is the SMILES notation for 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one?
The canonical SMILES for 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one is CCCCSC(CC(C)=O)C1C(C)=CCCC1(C)C.
What is the InChIKey of 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one?
The InChIKey is CDHHFGQDWHWCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30OS/c1-6-7-11-19-15(12-14(3)18)16-13(2)9-8-10-17(16,4)5/h9,15-16H,6-8,10-12H2,1-5H3.
What are the key properties of 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one?
4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one has a molecular weight of 282.49 g/mol, XLogP of 5.25, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylsulfanyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-one is sourced from PubChem (CID 58756306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).